C17H10F4N2O2S — CID 11222778
N-(4-fluorophenyl)-6-[5-(trifluoromethyl)thiophen-3-yl]oxypyridine-2-carboxamide (PubChem CID 11222778) has the molecular formula C17H10F4N2O2S and a molecular weight of 382.34 g/mol. Its IUPAC name is N-(4-fluorophenyl)-6-[5-(trifluoromethyl)thiophen-3-yl]oxypyridine-2-carboxamide.
| Compound Name | N-(4-fluorophenyl)-6-[5-(trifluoromethyl)thiophen-3-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 11222778 |
| Molecular Formula | C17H10F4N2O2S |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | N-(4-fluorophenyl)-6-[5-(trifluoromethyl)thiophen-3-yl]oxypyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cccc(Oc2csc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C17H10F4N2O2S/c18-10-4-6-11(7-5-10)22-16(24)13-2-1-3-15(23-13)25-12-8-14(26-9-12)17(19,20)21/h1-9H,(H,22,24) |
| InChIKey | CEMHYRIPNFHPAE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |