C16H15F3N2O2 — CID 18326225
N-propyl-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxamide (PubChem CID 18326225) has the molecular formula C16H15F3N2O2 and a molecular weight of 324.30 g/mol. Its IUPAC name is N-propyl-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxamide.
| Compound Name | N-propyl-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 18326225 |
| Molecular Formula | C16H15F3N2O2 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-propyl-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxamide |
| SMILES | CCCNC(=O)c1cccc(Oc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C16H15F3N2O2/c1-2-9-20-15(22)13-7-4-8-14(21-13)23-12-6-3-5-11(10-12)16(17,18)19/h3-8,10H,2,9H2,1H3,(H,20,22) |
| InChIKey | CNTFNWAVVQOFRG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |