C17H16F3N5O4 — CID 54216258
2-N'-[3-oxo-3-[6-[3-(trifluoromethyl)phenoxy]-2-pyridinyl]propyl]ethanedihydrazide (PubChem CID 54216258) has the molecular formula C17H16F3N5O4 and a molecular weight of 411.34 g/mol. Its IUPAC name is 2-N'-[3-oxo-3-[6-[3-(trifluoromethyl)phenoxy]-2-pyridinyl]propyl]ethanedihydrazide.
| Compound Name | 2-N'-[3-oxo-3-[6-[3-(trifluoromethyl)phenoxy]-2-pyridinyl]propyl]ethanedihydrazide |
|---|---|
| PubChem CID | 54216258 |
| Molecular Formula | C17H16F3N5O4 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2-N'-[3-oxo-3-[6-[3-(trifluoromethyl)phenoxy]-2-pyridinyl]propyl]ethanedihydrazide |
| SMILES | NNC(=O)C(=O)NNCCC(=O)c1cccc(Oc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C17H16F3N5O4/c18-17(19,20)10-3-1-4-11(9-10)29-14-6-2-5-12(23-14)13(26)7-8-22-25-16(28)15(27)24-21/h1-6,9,22H,7-8,21H2,(H,24,27)(H,25,28) |
| InChIKey | PZKAJKUUEWERNN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|