C18H14F3N3O2 — CID 52655302
N-[2-[3-(trifluoromethyl)phenoxy]ethyl]quinoxaline-2-carboxamide (PubChem CID 52655302) has the molecular formula C18H14F3N3O2 and a molecular weight of 361.32 g/mol. Its IUPAC name is N-[2-[3-(trifluoromethyl)phenoxy]ethyl]quinoxaline-2-carboxamide.
| Compound Name | N-[2-[3-(trifluoromethyl)phenoxy]ethyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 52655302 |
| Molecular Formula | C18H14F3N3O2 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-[2-[3-(trifluoromethyl)phenoxy]ethyl]quinoxaline-2-carboxamide |
| SMILES | O=C(NCCOc1cccc(C(F)(F)F)c1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C18H14F3N3O2/c19-18(20,21)12-4-3-5-13(10-12)26-9-8-22-17(25)16-11-23-14-6-1-2-7-15(14)24-16/h1-7,10-11H,8-9H2,(H,22,25) |
| InChIKey | SKQMDYKVCYMDRL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|