C20H17F4N3O2 — CID 55853865
7-fluoro-2,3-dimethyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]quinoxaline-5-carboxamide (PubChem CID 55853865) has the molecular formula C20H17F4N3O2 and a molecular weight of 407.37 g/mol. Its IUPAC name is 7-fluoro-2,3-dimethyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]quinoxaline-5-carboxamide.
| Compound Name | 7-fluoro-2,3-dimethyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]quinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 55853865 |
| Molecular Formula | C20H17F4N3O2 |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 7-fluoro-2,3-dimethyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]quinoxaline-5-carboxamide |
| SMILES | Cc1nc2cc(F)cc(C(=O)NCCOc3cccc(C(F)(F)F)c3)c2nc1C |
| InChI | InChI=1S/C20H17F4N3O2/c1-11-12(2)27-18-16(9-14(21)10-17(18)26-11)19(28)25-6-7-29-15-5-3-4-13(8-15)20(22,23)24/h3-5,8-10H,6-7H2,1-2H3,(H,25,28) |
| InChIKey | QFSRRELXIFADAC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|