C21H22FN3O2 — CID 55823828
7-fluoro-2,3-dimethyl-N-[3-(3-methylphenoxy)propyl]quinoxaline-5-carboxamide (PubChem CID 55823828) has the molecular formula C21H22FN3O2 and a molecular weight of 367.42 g/mol. Its IUPAC name is 7-fluoro-2,3-dimethyl-N-[3-(3-methylphenoxy)propyl]quinoxaline-5-carboxamide.
| Compound Name | 7-fluoro-2,3-dimethyl-N-[3-(3-methylphenoxy)propyl]quinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 55823828 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 7-fluoro-2,3-dimethyl-N-[3-(3-methylphenoxy)propyl]quinoxaline-5-carboxamide |
| SMILES | Cc1cccc(OCCCNC(=O)c2cc(F)cc3nc(C)c(C)nc23)c1 |
| InChI | InChI=1S/C21H22FN3O2/c1-13-6-4-7-17(10-13)27-9-5-8-23-21(26)18-11-16(22)12-19-20(18)25-15(3)14(2)24-19/h4,6-7,10-12H,5,8-9H2,1-3H3,(H,23,26) |
| InChIKey | FODMTRADAZONQN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|