C18H16F6N2O4 — CID 71547711
3-hydroxy-1-methyl-2-oxo-6-(trifluoromethyl)-N-[3-[3-(trifluoromethyl)phenoxy]propyl]pyridine-4-carboxamide (PubChem CID 71547711) has the molecular formula C18H16F6N2O4 and a molecular weight of 438.32 g/mol. Its IUPAC name is 3-hydroxy-1-methyl-2-oxo-6-(trifluoromethyl)-N-[3-[3-(trifluoromethyl)phenoxy]propyl]pyridine-4-carboxamide.
| Compound Name | 3-hydroxy-1-methyl-2-oxo-6-(trifluoromethyl)-N-[3-[3-(trifluoromethyl)phenoxy]propyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 71547711 |
| Molecular Formula | C18H16F6N2O4 |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 3-hydroxy-1-methyl-2-oxo-6-(trifluoromethyl)-N-[3-[3-(trifluoromethyl)phenoxy]propyl]pyridine-4-carboxamide |
| SMILES | Cn1c(C(F)(F)F)cc(C(=O)NCCCOc2cccc(C(F)(F)F)c2)c(O)c1=O |
| InChI | InChI=1S/C18H16F6N2O4/c1-26-13(18(22,23)24)9-12(14(27)16(26)29)15(28)25-6-3-7-30-11-5-2-4-10(8-11)17(19,20)21/h2,4-5,8-9,27H,3,6-7H2,1H3,(H,25,28) |
| InChIKey | DVBIKOCJCARIIP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|