C17H10BF4NO3 — CID 162618392
4-fluoro-2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline (PubChem CID 162618392) has the molecular formula C17H10BF4NO3 and a molecular weight of 363.08 g/mol. Its IUPAC name is 4-fluoro-2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline.
| Compound Name | 4-fluoro-2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 162618392 |
| Molecular Formula | C17H10BF4NO3 |
| Molecular Weight | 363.08 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 4-fluoro-2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline |
| SMILES | OB1OCc2cc(Oc3cc(F)c4cc(C(F)(F)F)ccc4n3)ccc21 |
| InChI | InChI=1S/C17H10BF4NO3/c19-14-7-16(23-15-4-1-10(6-12(14)15)17(20,21)22)26-11-2-3-13-9(5-11)8-25-18(13)24/h1-7,24H,8H2 |
| InChIKey | BGTUVOJTXRKXLD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.08 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|