C14H19FO — CID 151913158
6-fluoro-3-pentyl-3,4-dihydro-2H-chromene (PubChem CID 151913158) has the molecular formula C14H19FO and a molecular weight of 222.30 g/mol. Its IUPAC name is 6-fluoro-3-pentyl-3,4-dihydro-2H-chromene.
| Compound Name | 6-fluoro-3-pentyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 151913158 |
| Molecular Formula | C14H19FO |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 6-fluoro-3-pentyl-3,4-dihydro-2H-chromene |
| SMILES | CCCCCC1COc2ccc(F)cc2C1 |
| InChI | InChI=1S/C14H19FO/c1-2-3-4-5-11-8-12-9-13(15)6-7-14(12)16-10-11/h6-7,9,11H,2-5,8,10H2,1H3 |
| InChIKey | SVEYYZOJFVYVRN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|