C30H40F2O4 — CID 157427386
6-fluoro-3-pentyl-3,4-dihydro-2H-chromene-7-carbaldehyde;(6-fluoro-3-pentyl-3,4-dihydro-2H-chromen-7-yl)methanol (PubChem CID 157427386) has the molecular formula C30H40F2O4 and a molecular weight of 502.64 g/mol. Its IUPAC name is 6-fluoro-3-pentyl-3,4-dihydro-2H-chromene-7-carbaldehyde;(6-fluoro-3-pentyl-3,4-dihydro-2H-chromen-7-yl)methanol.
| Compound Name | 6-fluoro-3-pentyl-3,4-dihydro-2H-chromene-7-carbaldehyde;(6-fluoro-3-pentyl-3,4-dihydro-2H-chromen-7-yl)methanol |
|---|---|
| PubChem CID | 157427386 |
| Molecular Formula | C30H40F2O4 |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | 6-fluoro-3-pentyl-3,4-dihydro-2H-chromene-7-carbaldehyde;(6-fluoro-3-pentyl-3,4-dihydro-2H-chromen-7-yl)methanol |
| SMILES | CCCCCC1COc2cc(C=O)c(F)cc2C1.CCCCCC1COc2cc(CO)c(F)cc2C1 |
| InChI | InChI=1S/C15H21FO2.C15H19FO2/c2*1-2-3-4-5-11-6-12-7-14(16)13(9-17)8-15(12)18-10-11/h7-8,11,17H,2-6,9-10H2,1H3;7-9,11H,2-6,10H2,1H3 |
| InChIKey | BQCSDMOBZXUKKB-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|