C48H55Br2F2O2P — CID 158654096
7-(bromomethyl)-6-fluoro-3-pentyl-3,4-dihydro-2H-chromene;(6-fluoro-3-pentyl-3,4-dihydro-2H-chromen-7-yl)methyl-triphenylphosphanium;bromide (PubChem CID 158654096) has the molecular formula C48H55Br2F2O2P and a molecular weight of 892.74 g/mol. Its IUPAC name is 7-(bromomethyl)-6-fluoro-3-pentyl-3,4-dihydro-2H-chromene;(6-fluoro-3-pentyl-3,4-dihydro-2H-chromen-7-yl)methyl-triphenylphosphanium;bromide.
| Compound Name | 7-(bromomethyl)-6-fluoro-3-pentyl-3,4-dihydro-2H-chromene;(6-fluoro-3-pentyl-3,4-dihydro-2H-chromen-7-yl)methyl-triphenylphosphanium;bromide |
|---|---|
| PubChem CID | 158654096 |
| Molecular Formula | C48H55Br2F2O2P |
| Molecular Weight | 892.74 g/mol |
| Exact Mass | 890.23 |
| IUPAC Name | 7-(bromomethyl)-6-fluoro-3-pentyl-3,4-dihydro-2H-chromene;(6-fluoro-3-pentyl-3,4-dihydro-2H-chromen-7-yl)methyl-triphenylphosphanium;bromide |
| SMILES | CCCCCC1COc2cc(CBr)c(F)cc2C1.CCCCCC1COc2cc(C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)c(F)cc2C1.[Br-] |
| InChI | InChI=1S/C33H35FOP.C15H20BrFO.BrH/c1-2-3-7-14-26-21-27-22-32(34)28(23-33(27)35-24-26)25-36(29-15-8-4-9-16-29,30-17-10-5-11-18-30)31-19-12-6-13-20-31;1-2-3-4-5-11-6-12-7-14(17)13(9-16)8-15(12)18-10-11;/h4-6,8-13,15-20,22-23,26H,2-3,7,14,21,24-25H2,1H3;7-8,11H,2-6,9-10H2,1H3;1H/q+1;;/p-1 |
| InChIKey | HCUBPZHABHJWQA-UHFFFAOYSA-M |
| XLogP | 9.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.74 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|