C16H21FO — CID 143211285
6-fluoro-3-(4-methylcyclohexyl)-3,4-dihydro-2H-chromene (PubChem CID 143211285) has the molecular formula C16H21FO and a molecular weight of 248.34 g/mol. Its IUPAC name is 6-fluoro-3-(4-methylcyclohexyl)-3,4-dihydro-2H-chromene.
| Compound Name | 6-fluoro-3-(4-methylcyclohexyl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 143211285 |
| Molecular Formula | C16H21FO |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 6-fluoro-3-(4-methylcyclohexyl)-3,4-dihydro-2H-chromene |
| SMILES | CC1CCC(C2COc3ccc(F)cc3C2)CC1 |
| InChI | InChI=1S/C16H21FO/c1-11-2-4-12(5-3-11)14-8-13-9-15(17)6-7-16(13)18-10-14/h6-7,9,11-12,14H,2-5,8,10H2,1H3 |
| InChIKey | KCWOWOVVBGTCFN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |