C8H8FNO — CID 175342122
5-fluoro-1-methyl-3H-2,1-benzoxazole (PubChem CID 175342122) has the molecular formula C8H8FNO and a molecular weight of 153.16 g/mol. Its IUPAC name is 5-fluoro-1-methyl-3H-2,1-benzoxazole.
| Compound Name | 5-fluoro-1-methyl-3H-2,1-benzoxazole |
|---|---|
| PubChem CID | 175342122 |
| Molecular Formula | C8H8FNO |
| Molecular Weight | 153.16 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 5-fluoro-1-methyl-3H-2,1-benzoxazole |
| SMILES | CN1OCc2cc(F)ccc21 |
| InChI | InChI=1S/C8H8FNO/c1-10-8-3-2-7(9)4-6(8)5-11-10/h2-4H,5H2,1H3 |
| InChIKey | PCQIZWQAIBBPMM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.16 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |