C10H11FN2O2 — CID 117272948
1-(2-aminoethyl)-6-fluoro-4H-3,1-benzoxazin-2-one (PubChem CID 117272948) has the molecular formula C10H11FN2O2 and a molecular weight of 210.21 g/mol. Its IUPAC name is 1-(2-aminoethyl)-6-fluoro-4H-3,1-benzoxazin-2-one.
| Compound Name | 1-(2-aminoethyl)-6-fluoro-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 117272948 |
| Molecular Formula | C10H11FN2O2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-(2-aminoethyl)-6-fluoro-4H-3,1-benzoxazin-2-one |
| SMILES | NCCN1C(=O)OCc2cc(F)ccc21 |
| InChI | InChI=1S/C10H11FN2O2/c11-8-1-2-9-7(5-8)6-15-10(14)13(9)4-3-12/h1-2,5H,3-4,6,12H2 |
| InChIKey | AKHDDBSCDCKQNG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |