C11H13FN2O — CID 82279729
2-(2-aminoethyl)-6-fluoro-3,4-dihydroisoquinolin-1-one (PubChem CID 82279729) has the molecular formula C11H13FN2O and a molecular weight of 208.24 g/mol. Its IUPAC name is 2-(2-aminoethyl)-6-fluoro-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-(2-aminoethyl)-6-fluoro-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 82279729 |
| Molecular Formula | C11H13FN2O |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-(2-aminoethyl)-6-fluoro-3,4-dihydroisoquinolin-1-one |
| SMILES | NCCN1CCc2cc(F)ccc2C1=O |
| InChI | InChI=1S/C11H13FN2O/c12-9-1-2-10-8(7-9)3-5-14(6-4-13)11(10)15/h1-2,7H,3-6,13H2 |
| InChIKey | NIENGDCSFUJDGA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |