C10H9FO — CID 116532256
6-fluorospiro[1,2-dihydroindene-3,2'-oxirane] (PubChem CID 116532256) has the molecular formula C10H9FO and a molecular weight of 164.18 g/mol. Its IUPAC name is 6-fluorospiro[1,2-dihydroindene-3,2'-oxirane].
| Compound Name | 6-fluorospiro[1,2-dihydroindene-3,2'-oxirane] |
|---|---|
| PubChem CID | 116532256 |
| Molecular Formula | C10H9FO |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 6-fluorospiro[1,2-dihydroindene-3,2'-oxirane] |
| SMILES | Fc1ccc2c(c1)CCC21CO1 |
| InChI | InChI=1S/C10H9FO/c11-8-1-2-9-7(5-8)3-4-10(9)6-12-10/h1-2,5H,3-4,6H2 |
| InChIKey | QYZCCXOPKRDKGN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|