C9H8F2O — CID 123185465
(2S)-2-(2,4-difluorophenyl)-2-methyloxirane (PubChem CID 123185465) has the molecular formula C9H8F2O and a molecular weight of 170.16 g/mol. Its IUPAC name is (2S)-2-(2,4-difluorophenyl)-2-methyloxirane.
| Compound Name | (2S)-2-(2,4-difluorophenyl)-2-methyloxirane |
|---|---|
| PubChem CID | 123185465 |
| Molecular Formula | C9H8F2O |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | (2S)-2-(2,4-difluorophenyl)-2-methyloxirane |
| SMILES | C[C@]1(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C9H8F2O/c1-9(5-12-9)7-3-2-6(10)4-8(7)11/h2-4H,5H2,1H3/t9-/m1/s1 |
| InChIKey | JQVLPAOXALFOPV-SECBINFHSA-N |
| XLogP | 2.21 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|