C11H12F2O2 — CID 139793678
(2S)-2-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]propan-1-ol (PubChem CID 139793678) has the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. Its IUPAC name is (2S)-2-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]propan-1-ol.
| Compound Name | (2S)-2-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 139793678 |
| Molecular Formula | C11H12F2O2 |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (2S)-2-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]propan-1-ol |
| SMILES | C[C@@H](CO)[C@@]1(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C11H12F2O2/c1-7(5-14)11(6-15-11)9-3-2-8(12)4-10(9)13/h2-4,7,14H,5-6H2,1H3/t7-,11+/m0/s1 |
| InChIKey | IQKNANGRXROSMT-WRWORJQWSA-N |
| XLogP | 1.82 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|