About [(1S)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl] trifluoromethanesulfonate
[(1S)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl] trifluoromethanesulfonate (PubChem CID 10758948) has the molecular formula C11H9F5O4S
and a molecular weight of 332.25 g/mol. Its IUPAC name is [(1S)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(1S)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl] trifluoromethanesulfonate |
| PubChem CID | 10758948 |
| Molecular Formula | C11H9F5O4S |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | [(1S)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl] trifluoromethanesulfonate |
| SMILES | C[C@H](OS(=O)(=O)C(F)(F)F)[C@@]1(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C11H9F5O4S/c1-6(20-21(17,18)11(14,15)16)10(5-19-10)8-3-2-7(12)4-9(8)13/h2-4,6H,5H2,1H3/t6-,10+/m0/s1 |
| InChIKey | PFOAMCWXVGRGNW-QUBYGPBYSA-N |
| XLogP | 2.44 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl] trifluoromethanesulfonate?
The IUPAC name of [(1S)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl] trifluoromethanesulfonate (CID 10758948) is [(1S)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl] trifluoromethanesulfonate.
What is the SMILES notation for [(1S)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl] trifluoromethanesulfonate?
The canonical SMILES for [(1S)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl] trifluoromethanesulfonate is C[C@H](OS(=O)(=O)C(F)(F)F)[C@@]1(c2ccc(F)cc2F)CO1.
What is the InChIKey of [(1S)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl] trifluoromethanesulfonate?
The InChIKey is PFOAMCWXVGRGNW-QUBYGPBYSA-N. The full InChI is InChI=1S/C11H9F5O4S/c1-6(20-21(17,18)11(14,15)16)10(5-19-10)8-3-2-7(12)4-9(8)13/h2-4,6H,5H2,1H3/t6-,10+/m0/s1.
What are the key properties of [(1S)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl] trifluoromethanesulfonate?
[(1S)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl] trifluoromethanesulfonate has a molecular weight of 332.25 g/mol, XLogP of 2.44, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl] trifluoromethanesulfonate is sourced from PubChem (CID 10758948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).