C19H14F6N4O3 — CID 10790126
1-[(1R)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]tetrazol-5-one (PubChem CID 10790126) has the molecular formula C19H14F6N4O3 and a molecular weight of 460.33 g/mol. Its IUPAC name is 1-[(1R)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]tetrazol-5-one.
| Compound Name | 1-[(1R)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]tetrazol-5-one |
|---|---|
| PubChem CID | 10790126 |
| Molecular Formula | C19H14F6N4O3 |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 1-[(1R)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]tetrazol-5-one |
| SMILES | C[C@@H](n1nnn(-c2ccc(OC(F)(F)C(F)F)cc2)c1=O)[C@@]1(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C19H14F6N4O3/c1-10(18(9-31-18)14-7-2-11(20)8-15(14)21)28-17(30)29(27-26-28)12-3-5-13(6-4-12)32-19(24,25)16(22)23/h2-8,10,16H,9H2,1H3/t10-,18-/m1/s1 |
| InChIKey | BTSJMZUYVVVJBU-MLCYQJTMSA-N |
| XLogP | 3.43 |
| TPSA | 74.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|