C18H14ClF2N3O2 — CID 19373645
1-(4-chlorophenyl)-5-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethoxy]-1,2,4-triazole (PubChem CID 19373645) has the molecular formula C18H14ClF2N3O2 and a molecular weight of 377.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethoxy]-1,2,4-triazole.
| Compound Name | 1-(4-chlorophenyl)-5-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethoxy]-1,2,4-triazole |
|---|---|
| PubChem CID | 19373645 |
| Molecular Formula | C18H14ClF2N3O2 |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethoxy]-1,2,4-triazole |
| SMILES | CC(Oc1ncnn1-c1ccc(Cl)cc1)C1(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C18H14ClF2N3O2/c1-11(18(9-25-18)15-7-4-13(20)8-16(15)21)26-17-22-10-23-24(17)14-5-2-12(19)3-6-14/h2-8,10-11H,9H2,1H3 |
| InChIKey | NFRRCAJOVINYSK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|