C27H34F2N6O2 — CID 11237590
1-(2-butoxyphenyl)-4-[2-[1-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine (PubChem CID 11237590) has the molecular formula C27H34F2N6O2 and a molecular weight of 512.61 g/mol. Its IUPAC name is 1-(2-butoxyphenyl)-4-[2-[1-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine.
| Compound Name | 1-(2-butoxyphenyl)-4-[2-[1-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine |
|---|---|
| PubChem CID | 11237590 |
| Molecular Formula | C27H34F2N6O2 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | 1-(2-butoxyphenyl)-4-[2-[1-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine |
| SMILES | CCCCOc1ccccc1N1CCN(CCc2nnnn2C(C)C2(c3ccc(F)cc3F)CO2)CC1 |
| InChI | InChI=1S/C27H34F2N6O2/c1-3-4-17-36-25-8-6-5-7-24(25)34-15-13-33(14-16-34)12-11-26-30-31-32-35(26)20(2)27(19-37-27)22-10-9-21(28)18-23(22)29/h5-10,18,20H,3-4,11-17,19H2,1-2H3 |
| InChIKey | LGJVXIBVLRLZHT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 71.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|