C23H24Cl2F2N6O — CID 11260722
1-(2,4-dichlorophenyl)-4-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine (PubChem CID 11260722) has the molecular formula C23H24Cl2F2N6O and a molecular weight of 509.39 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-4-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine.
| Compound Name | 1-(2,4-dichlorophenyl)-4-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine |
|---|---|
| PubChem CID | 11260722 |
| Molecular Formula | C23H24Cl2F2N6O |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-4-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine |
| SMILES | CC(n1nnc(CCN2CCN(c3ccc(Cl)cc3Cl)CC2)n1)C1(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C23H24Cl2F2N6O/c1-15(23(14-34-23)18-4-3-17(26)13-20(18)27)33-29-22(28-30-33)6-7-31-8-10-32(11-9-31)21-5-2-16(24)12-19(21)25/h2-5,12-13,15H,6-11,14H2,1H3 |
| InChIKey | MSQRUQZPXAAKLZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 62.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|