C23H25ClF2N6O — CID 11213657
1-(4-chlorophenyl)-4-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine (PubChem CID 11213657) has the molecular formula C23H25ClF2N6O and a molecular weight of 474.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine.
| Compound Name | 1-(4-chlorophenyl)-4-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine |
|---|---|
| PubChem CID | 11213657 |
| Molecular Formula | C23H25ClF2N6O |
| Molecular Weight | 474.94 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 1-(4-chlorophenyl)-4-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine |
| SMILES | CC(n1nnc(CCN2CCN(c3ccc(Cl)cc3)CC2)n1)C1(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C23H25ClF2N6O/c1-16(23(15-33-23)20-7-4-18(25)14-21(20)26)32-28-22(27-29-32)8-9-30-10-12-31(13-11-30)19-5-2-17(24)3-6-19/h2-7,14,16H,8-13,15H2,1H3 |
| InChIKey | VXLZYWGSHPDEQI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 62.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.94 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|