C23H26F2N6O — CID 11236021
1-[2-[1-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]-4-phenylpiperazine (PubChem CID 11236021) has the molecular formula C23H26F2N6O and a molecular weight of 440.50 g/mol. Its IUPAC name is 1-[2-[1-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]-4-phenylpiperazine.
| Compound Name | 1-[2-[1-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 11236021 |
| Molecular Formula | C23H26F2N6O |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 1-[2-[1-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]-4-phenylpiperazine |
| SMILES | CC(n1nnnc1CCN1CCN(c2ccccc2)CC1)C1(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C23H26F2N6O/c1-17(23(16-32-23)20-8-7-18(24)15-21(20)25)31-22(26-27-28-31)9-10-29-11-13-30(14-12-29)19-5-3-2-4-6-19/h2-8,15,17H,9-14,16H2,1H3 |
| InChIKey | DZUVCEUXENWMRL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 62.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|