C21H25FN6O — CID 3209271
1-(2-fluorophenyl)-4-[[1-(2-methoxyethyl)tetrazol-5-yl]-phenylmethyl]piperazine (PubChem CID 3209271) has the molecular formula C21H25FN6O and a molecular weight of 396.47 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4-[[1-(2-methoxyethyl)tetrazol-5-yl]-phenylmethyl]piperazine.
| Compound Name | 1-(2-fluorophenyl)-4-[[1-(2-methoxyethyl)tetrazol-5-yl]-phenylmethyl]piperazine |
|---|---|
| PubChem CID | 3209271 |
| Molecular Formula | C21H25FN6O |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 1-(2-fluorophenyl)-4-[[1-(2-methoxyethyl)tetrazol-5-yl]-phenylmethyl]piperazine |
| SMILES | COCCn1nnnc1C(c1ccccc1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C21H25FN6O/c1-29-16-15-28-21(23-24-25-28)20(17-7-3-2-4-8-17)27-13-11-26(12-14-27)19-10-6-5-9-18(19)22/h2-10,20H,11-16H2,1H3 |
| InChIKey | ZTXBFFQYKYMLME-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |