C22H32N6O — CID 648818
4-[(1-cyclohexyltetrazol-5-yl)-(4-pyrrolidin-1-ylphenyl)methyl]morpholine (PubChem CID 648818) has the molecular formula C22H32N6O and a molecular weight of 396.54 g/mol. Its IUPAC name is 4-[(1-cyclohexyltetrazol-5-yl)-(4-pyrrolidin-1-ylphenyl)methyl]morpholine.
| Compound Name | 4-[(1-cyclohexyltetrazol-5-yl)-(4-pyrrolidin-1-ylphenyl)methyl]morpholine |
|---|---|
| PubChem CID | 648818 |
| Molecular Formula | C22H32N6O |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 4-[(1-cyclohexyltetrazol-5-yl)-(4-pyrrolidin-1-ylphenyl)methyl]morpholine |
| SMILES | c1cc(N2CCCC2)ccc1C(c1nnnn1C1CCCCC1)N1CCOCC1 |
| InChI | InChI=1S/C22H32N6O/c1-2-6-20(7-3-1)28-22(23-24-25-28)21(27-14-16-29-17-15-27)18-8-10-19(11-9-18)26-12-4-5-13-26/h8-11,20-21H,1-7,12-17H2 |
| InChIKey | FHSDHYWTCZJBET-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|