C20H32N6 — CID 650290
4-[(1-tert-butyltetrazol-5-yl)-(4-methylpiperidin-1-yl)methyl]-N,N-dimethylaniline (PubChem CID 650290) has the molecular formula C20H32N6 and a molecular weight of 356.52 g/mol. Its IUPAC name is 4-[(1-tert-butyltetrazol-5-yl)-(4-methylpiperidin-1-yl)methyl]-N,N-dimethylaniline.
| Compound Name | 4-[(1-tert-butyltetrazol-5-yl)-(4-methylpiperidin-1-yl)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 650290 |
| Molecular Formula | C20H32N6 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 4-[(1-tert-butyltetrazol-5-yl)-(4-methylpiperidin-1-yl)methyl]-N,N-dimethylaniline |
| SMILES | CC1CCN(C(c2ccc(N(C)C)cc2)c2nnnn2C(C)(C)C)CC1 |
| InChI | InChI=1S/C20H32N6/c1-15-11-13-25(14-12-15)18(16-7-9-17(10-8-16)24(5)6)19-21-22-23-26(19)20(2,3)4/h7-10,15,18H,11-14H2,1-6H3 |
| InChIKey | SUCCGCXLAVVJOL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|