C24H28F2N6O — CID 11408415
1-benzyl-4-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine (PubChem CID 11408415) has the molecular formula C24H28F2N6O and a molecular weight of 454.53 g/mol. Its IUPAC name is 1-benzyl-4-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine.
| Compound Name | 1-benzyl-4-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine |
|---|---|
| PubChem CID | 11408415 |
| Molecular Formula | C24H28F2N6O |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 1-benzyl-4-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine |
| SMILES | CC(n1nnc(CCN2CCN(Cc3ccccc3)CC2)n1)C1(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C24H28F2N6O/c1-18(24(17-33-24)21-8-7-20(25)15-22(21)26)32-28-23(27-29-32)9-10-30-11-13-31(14-12-30)16-19-5-3-2-4-6-19/h2-8,15,18H,9-14,16-17H2,1H3 |
| InChIKey | AABLEXIOKBCZBX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 62.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|