C23H25F2N7O3 — CID 11397586
1-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]-4-(4-nitrophenyl)piperazine (PubChem CID 11397586) has the molecular formula C23H25F2N7O3 and a molecular weight of 485.50 g/mol. Its IUPAC name is 1-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]-4-(4-nitrophenyl)piperazine.
| Compound Name | 1-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]-4-(4-nitrophenyl)piperazine |
|---|---|
| PubChem CID | 11397586 |
| Molecular Formula | C23H25F2N7O3 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 1-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]-4-(4-nitrophenyl)piperazine |
| SMILES | CC(n1nnc(CCN2CCN(c3ccc([N+](=O)[O-])cc3)CC2)n1)C1(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C23H25F2N7O3/c1-16(23(15-35-23)20-7-2-17(24)14-21(20)25)31-27-22(26-28-31)8-9-29-10-12-30(13-11-29)18-3-5-19(6-4-18)32(33)34/h2-7,14,16H,8-13,15H2,1H3 |
| InChIKey | OTLFTWREZRSMMY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 105.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|