C15H20F2N2O3 — CID 87913415
tert-butyl N-amino-N-[(1R)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]carbamate (PubChem CID 87913415) has the molecular formula C15H20F2N2O3 and a molecular weight of 314.33 g/mol. Its IUPAC name is tert-butyl N-amino-N-[(1R)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-amino-N-[(1R)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 87913415 |
| Molecular Formula | C15H20F2N2O3 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | tert-butyl N-amino-N-[(1R)-1-[(2R)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]carbamate |
| SMILES | C[C@@H](N(N)C(=O)OC(C)(C)C)[C@]1(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C15H20F2N2O3/c1-9(19(18)13(20)22-14(2,3)4)15(8-21-15)11-6-5-10(16)7-12(11)17/h5-7,9H,8,18H2,1-4H3/t9-,15+/m1/s1 |
| InChIKey | XGDBSMADAUNNSW-PSLIRLAXSA-N |
| XLogP | 2.69 |
| TPSA | 68.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|