C10H10F2O2 — CID 116829723
[3-(2,4-difluorophenyl)oxetan-3-yl]methanol (PubChem CID 116829723) has the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. Its IUPAC name is [3-(2,4-difluorophenyl)oxetan-3-yl]methanol.
| Compound Name | [3-(2,4-difluorophenyl)oxetan-3-yl]methanol |
|---|---|
| PubChem CID | 116829723 |
| Molecular Formula | C10H10F2O2 |
| Molecular Weight | 200.18 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | [3-(2,4-difluorophenyl)oxetan-3-yl]methanol |
| SMILES | OCC1(c2ccc(F)cc2F)COC1 |
| InChI | InChI=1S/C10H10F2O2/c11-7-1-2-8(9(12)3-7)10(4-13)5-14-6-10/h1-3,13H,4-6H2 |
| InChIKey | SOBLFZVQJZNFAY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.18 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |