C10H11F2NO — CID 83485213
[3-(2,5-difluorophenyl)oxetan-3-yl]methanamine (PubChem CID 83485213) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is [3-(2,5-difluorophenyl)oxetan-3-yl]methanamine.
| Compound Name | [3-(2,5-difluorophenyl)oxetan-3-yl]methanamine |
|---|---|
| PubChem CID | 83485213 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | [3-(2,5-difluorophenyl)oxetan-3-yl]methanamine |
| SMILES | NCC1(c2cc(F)ccc2F)COC1 |
| InChI | InChI=1S/C10H11F2NO/c11-7-1-2-9(12)8(3-7)10(4-13)5-14-6-10/h1-3H,4-6,13H2 |
| InChIKey | KKMVAXAOORWGSM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |