C15H19F2NO — CID 116871274
4-[3-(2,5-difluorophenyl)oxetan-3-yl]cyclohexan-1-amine (PubChem CID 116871274) has the molecular formula C15H19F2NO and a molecular weight of 267.32 g/mol. Its IUPAC name is 4-[3-(2,5-difluorophenyl)oxetan-3-yl]cyclohexan-1-amine.
| Compound Name | 4-[3-(2,5-difluorophenyl)oxetan-3-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 116871274 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 4-[3-(2,5-difluorophenyl)oxetan-3-yl]cyclohexan-1-amine |
| SMILES | NC1CCC(C2(c3cc(F)ccc3F)COC2)CC1 |
| InChI | InChI=1S/C15H19F2NO/c16-11-3-6-14(17)13(7-11)15(8-19-9-15)10-1-4-12(18)5-2-10/h3,6-7,10,12H,1-2,4-5,8-9,18H2 |
| InChIKey | OYRNBCHFSPDRME-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |