C12H15F2N — CID 64515768
1-(2,5-difluorophenyl)-3-methylcyclopentan-1-amine (PubChem CID 64515768) has the molecular formula C12H15F2N and a molecular weight of 211.25 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-methylcyclopentan-1-amine.
| Compound Name | 1-(2,5-difluorophenyl)-3-methylcyclopentan-1-amine |
|---|---|
| PubChem CID | 64515768 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-methylcyclopentan-1-amine |
| SMILES | CC1CCC(N)(c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C12H15F2N/c1-8-4-5-12(15,7-8)10-6-9(13)2-3-11(10)14/h2-3,6,8H,4-5,7,15H2,1H3 |
| InChIKey | CFMGDDTYKHPZIB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |