C12H14F3N — CID 112567534
3-(2,5-difluorophenyl)-3-fluorocyclohexan-1-amine (PubChem CID 112567534) has the molecular formula C12H14F3N and a molecular weight of 229.24 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)-3-fluorocyclohexan-1-amine.
| Compound Name | 3-(2,5-difluorophenyl)-3-fluorocyclohexan-1-amine |
|---|---|
| PubChem CID | 112567534 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-(2,5-difluorophenyl)-3-fluorocyclohexan-1-amine |
| SMILES | NC1CCCC(F)(c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C12H14F3N/c13-8-3-4-11(14)10(6-8)12(15)5-1-2-9(16)7-12/h3-4,6,9H,1-2,5,7,16H2 |
| InChIKey | NBRFVEGHPKULIM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |