C12H14Cl2FN — CID 112567366
3-(3,4-dichlorophenyl)-3-fluorocyclohexan-1-amine (PubChem CID 112567366) has the molecular formula C12H14Cl2FN and a molecular weight of 262.15 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-3-fluorocyclohexan-1-amine.
| Compound Name | 3-(3,4-dichlorophenyl)-3-fluorocyclohexan-1-amine |
|---|---|
| PubChem CID | 112567366 |
| Molecular Formula | C12H14Cl2FN |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-3-fluorocyclohexan-1-amine |
| SMILES | NC1CCCC(F)(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C12H14Cl2FN/c13-10-4-3-8(6-11(10)14)12(15)5-1-2-9(16)7-12/h3-4,6,9H,1-2,5,7,16H2 |
| InChIKey | PTNUVQGIBFDEOE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |