C12H18FN3 — CID 112567459
3-(3-amino-1-fluorocyclohexyl)-4-methylpyridin-2-amine (PubChem CID 112567459) has the molecular formula C12H18FN3 and a molecular weight of 223.29 g/mol. Its IUPAC name is 3-(3-amino-1-fluorocyclohexyl)-4-methylpyridin-2-amine.
| Compound Name | 3-(3-amino-1-fluorocyclohexyl)-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 112567459 |
| Molecular Formula | C12H18FN3 |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | 3-(3-amino-1-fluorocyclohexyl)-4-methylpyridin-2-amine |
| SMILES | Cc1ccnc(N)c1C1(F)CCCC(N)C1 |
| InChI | InChI=1S/C12H18FN3/c1-8-4-6-16-11(15)10(8)12(13)5-2-3-9(14)7-12/h4,6,9H,2-3,5,7,14H2,1H3,(H2,15,16) |
| InChIKey | NEMCVLZZHKOANS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |