C16H19FN2 — CID 112567479
3-fluoro-3-(quinolin-4-ylmethyl)cyclohexan-1-amine (PubChem CID 112567479) has the molecular formula C16H19FN2 and a molecular weight of 258.34 g/mol. Its IUPAC name is 3-fluoro-3-(quinolin-4-ylmethyl)cyclohexan-1-amine.
| Compound Name | 3-fluoro-3-(quinolin-4-ylmethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 112567479 |
| Molecular Formula | C16H19FN2 |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-fluoro-3-(quinolin-4-ylmethyl)cyclohexan-1-amine |
| SMILES | NC1CCCC(F)(Cc2ccnc3ccccc23)C1 |
| InChI | InChI=1S/C16H19FN2/c17-16(8-3-4-13(18)11-16)10-12-7-9-19-15-6-2-1-5-14(12)15/h1-2,5-7,9,13H,3-4,8,10-11,18H2 |
| InChIKey | ZMPMSHRKEUQKLD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |