About 2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile
2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile (PubChem CID 116873253) has the molecular formula C11H9F2NO
and a molecular weight of 209.19 g/mol. Its IUPAC name is 2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile |
| PubChem CID | 116873253 |
| Molecular Formula | C11H9F2NO |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile |
| SMILES | N#CCC1(c2cc(F)ccc2F)COC1 |
| InChI | InChI=1S/C11H9F2NO/c12-8-1-2-10(13)9(5-8)11(3-4-14)6-15-7-11/h1-2,5H,3,6-7H2 |
| InChIKey | KHCOOFPRGXSUBR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile?
The IUPAC name of 2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile (CID 116873253) is 2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile.
What is the SMILES notation for 2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile?
The canonical SMILES for 2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile is N#CCC1(c2cc(F)ccc2F)COC1.
What is the InChIKey of 2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile?
The InChIKey is KHCOOFPRGXSUBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2NO/c12-8-1-2-10(13)9(5-8)11(3-4-14)6-15-7-11/h1-2,5H,3,6-7H2.
What are the key properties of 2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile?
2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile has a molecular weight of 209.19 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile is sourced from PubChem (CID 116873253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).