C11H9F2NO — CID 116873253
2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile (PubChem CID 116873253) has the molecular formula C11H9F2NO and a molecular weight of 209.19 g/mol. Its IUPAC name is 2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile.
| Compound Name | 2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile |
|---|---|
| PubChem CID | 116873253 |
| Molecular Formula | C11H9F2NO |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-[3-(2,5-difluorophenyl)oxetan-3-yl]acetonitrile |
| SMILES | N#CCC1(c2cc(F)ccc2F)COC1 |
| InChI | InChI=1S/C11H9F2NO/c12-8-1-2-10(13)9(5-8)11(3-4-14)6-15-7-11/h1-2,5H,3,6-7H2 |
| InChIKey | KHCOOFPRGXSUBR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |