3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid

C12H13F2NO3 — CID 116874590

IUPAC3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid
SMILESNC(CC(=O)O)C1(c2ccc(F)cc2F)COC1
InChIInChI=1S/C12H13F2NO3/c13-7-1-2-8(9(14)3-7)12(5-18-6-12)10(15)4-11(16)17/h1-3,10H,4-6,15H2,(H,16,17)
InChIKeySGJHHMCERAQCQD-UHFFFAOYSA-N
MW257.24 g/mol
LogP1.03
Rot. Bonds4

About 3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid

3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid (PubChem CID 116874590) has the molecular formula C12H13F2NO3 and a molecular weight of 257.24 g/mol. Its IUPAC name is 3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid.

Molecular Properties

Compound Name3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid
PubChem CID116874590
Molecular FormulaC12H13F2NO3
Molecular Weight257.24 g/mol
Exact Mass257.09
IUPAC Name3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid
SMILESNC(CC(=O)O)C1(c2ccc(F)cc2F)COC1
InChIInChI=1S/C12H13F2NO3/c13-7-1-2-8(9(14)3-7)12(5-18-6-12)10(15)4-11(16)17/h1-3,10H,4-6,15H2,(H,16,17)
InChIKeySGJHHMCERAQCQD-UHFFFAOYSA-N
XLogP1.03
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.24
LogP ≤ 51.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid?
The IUPAC name of 3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid (CID 116874590) is 3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid.
What is the SMILES notation for 3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid?
The canonical SMILES for 3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid is NC(CC(=O)O)C1(c2ccc(F)cc2F)COC1.
What is the InChIKey of 3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid?
The InChIKey is SGJHHMCERAQCQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2NO3/c13-7-1-2-8(9(14)3-7)12(5-18-6-12)10(15)4-11(16)17/h1-3,10H,4-6,15H2,(H,16,17).
What are the key properties of 3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid?
3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid has a molecular weight of 257.24 g/mol, XLogP of 1.03, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid is sourced from PubChem (CID 116874590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).