C12H13F2NO3 — CID 116874590
3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid (PubChem CID 116874590) has the molecular formula C12H13F2NO3 and a molecular weight of 257.24 g/mol. Its IUPAC name is 3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid.
| Compound Name | 3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid |
|---|---|
| PubChem CID | 116874590 |
| Molecular Formula | C12H13F2NO3 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 3-amino-3-[3-(2,4-difluorophenyl)oxetan-3-yl]propanoic acid |
| SMILES | NC(CC(=O)O)C1(c2ccc(F)cc2F)COC1 |
| InChI | InChI=1S/C12H13F2NO3/c13-7-1-2-8(9(14)3-7)12(5-18-6-12)10(15)4-11(16)17/h1-3,10H,4-6,15H2,(H,16,17) |
| InChIKey | SGJHHMCERAQCQD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |