C16H19F2NO3 — CID 120522765
3-[[1-(2,4-difluorophenyl)cyclopentanecarbonyl]amino]butanoic acid (PubChem CID 120522765) has the molecular formula C16H19F2NO3 and a molecular weight of 311.33 g/mol. Its IUPAC name is 3-[[1-(2,4-difluorophenyl)cyclopentanecarbonyl]amino]butanoic acid.
| Compound Name | 3-[[1-(2,4-difluorophenyl)cyclopentanecarbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 120522765 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-[[1-(2,4-difluorophenyl)cyclopentanecarbonyl]amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)C1(c2ccc(F)cc2F)CCCC1 |
| InChI | InChI=1S/C16H19F2NO3/c1-10(8-14(20)21)19-15(22)16(6-2-3-7-16)12-5-4-11(17)9-13(12)18/h4-5,9-10H,2-3,6-8H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | USLKAQBXVYYBJQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |