C20H19F2NO3 — CID 120530680
2-[3-[[1-(2,4-difluorophenyl)cyclopentanecarbonyl]amino]phenyl]acetic acid (PubChem CID 120530680) has the molecular formula C20H19F2NO3 and a molecular weight of 359.37 g/mol. Its IUPAC name is 2-[3-[[1-(2,4-difluorophenyl)cyclopentanecarbonyl]amino]phenyl]acetic acid.
| Compound Name | 2-[3-[[1-(2,4-difluorophenyl)cyclopentanecarbonyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 120530680 |
| Molecular Formula | C20H19F2NO3 |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-[3-[[1-(2,4-difluorophenyl)cyclopentanecarbonyl]amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(NC(=O)C2(c3ccc(F)cc3F)CCCC2)c1 |
| InChI | InChI=1S/C20H19F2NO3/c21-14-6-7-16(17(22)12-14)20(8-1-2-9-20)19(26)23-15-5-3-4-13(10-15)11-18(24)25/h3-7,10,12H,1-2,8-9,11H2,(H,23,26)(H,24,25) |
| InChIKey | GUGNORSNVMHICO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |