C19H18FNO2 — CID 110438589
N-(3-acetylphenyl)-1-(2-fluorophenyl)cyclobutane-1-carboxamide (PubChem CID 110438589) has the molecular formula C19H18FNO2 and a molecular weight of 311.36 g/mol. Its IUPAC name is N-(3-acetylphenyl)-1-(2-fluorophenyl)cyclobutane-1-carboxamide.
| Compound Name | N-(3-acetylphenyl)-1-(2-fluorophenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 110438589 |
| Molecular Formula | C19H18FNO2 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-(3-acetylphenyl)-1-(2-fluorophenyl)cyclobutane-1-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)C2(c3ccccc3F)CCC2)c1 |
| InChI | InChI=1S/C19H18FNO2/c1-13(22)14-6-4-7-15(12-14)21-18(23)19(10-5-11-19)16-8-2-3-9-17(16)20/h2-4,6-9,12H,5,10-11H2,1H3,(H,21,23) |
| InChIKey | UDDJDUPAYRCQMQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |