C19H17F2NO3 — CID 122108126
2-[3-[[1-(2,6-difluorophenyl)cyclobutanecarbonyl]amino]phenyl]acetic acid (PubChem CID 122108126) has the molecular formula C19H17F2NO3 and a molecular weight of 345.35 g/mol. Its IUPAC name is 2-[3-[[1-(2,6-difluorophenyl)cyclobutanecarbonyl]amino]phenyl]acetic acid.
| Compound Name | 2-[3-[[1-(2,6-difluorophenyl)cyclobutanecarbonyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 122108126 |
| Molecular Formula | C19H17F2NO3 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 2-[3-[[1-(2,6-difluorophenyl)cyclobutanecarbonyl]amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(NC(=O)C2(c3c(F)cccc3F)CCC2)c1 |
| InChI | InChI=1S/C19H17F2NO3/c20-14-6-2-7-15(21)17(14)19(8-3-9-19)18(25)22-13-5-1-4-12(10-13)11-16(23)24/h1-2,4-7,10H,3,8-9,11H2,(H,22,25)(H,23,24) |
| InChIKey | RWHLRFFCLJUEOZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |