C11H12F2O3 — CID 116829775
[3-(2,5-difluoro-4-methoxyphenyl)oxetan-3-yl]methanol (PubChem CID 116829775) has the molecular formula C11H12F2O3 and a molecular weight of 230.21 g/mol. Its IUPAC name is [3-(2,5-difluoro-4-methoxyphenyl)oxetan-3-yl]methanol.
| Compound Name | [3-(2,5-difluoro-4-methoxyphenyl)oxetan-3-yl]methanol |
|---|---|
| PubChem CID | 116829775 |
| Molecular Formula | C11H12F2O3 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | [3-(2,5-difluoro-4-methoxyphenyl)oxetan-3-yl]methanol |
| SMILES | COc1cc(F)c(C2(CO)COC2)cc1F |
| InChI | InChI=1S/C11H12F2O3/c1-15-10-3-8(12)7(2-9(10)13)11(4-14)5-16-6-11/h2-3,14H,4-6H2,1H3 |
| InChIKey | HIIRKKWHSXJQEH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |