C10H10FNO — CID 155895187
6-fluorospiro[1H-2-benzofuran-3,3'-azetidine] (PubChem CID 155895187) has the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. Its IUPAC name is 6-fluorospiro[1H-2-benzofuran-3,3'-azetidine].
| Compound Name | 6-fluorospiro[1H-2-benzofuran-3,3'-azetidine] |
|---|---|
| PubChem CID | 155895187 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 6-fluorospiro[1H-2-benzofuran-3,3'-azetidine] |
| SMILES | Fc1ccc2c(c1)COC21CNC1 |
| InChI | InChI=1S/C10H10FNO/c11-8-1-2-9-7(3-8)4-13-10(9)5-12-6-10/h1-3,12H,4-6H2 |
| InChIKey | GQKHOPHVKSVSLG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |