C12H17FO — CID 144945393
ethane;5-fluoro-3,3-dimethyl-1H-2-benzofuran (PubChem CID 144945393) has the molecular formula C12H17FO and a molecular weight of 196.26 g/mol. Its IUPAC name is ethane;5-fluoro-3,3-dimethyl-1H-2-benzofuran.
| Compound Name | ethane;5-fluoro-3,3-dimethyl-1H-2-benzofuran |
|---|---|
| PubChem CID | 144945393 |
| Molecular Formula | C12H17FO |
| Molecular Weight | 196.26 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | ethane;5-fluoro-3,3-dimethyl-1H-2-benzofuran |
| SMILES | CC.CC1(C)OCc2ccc(F)cc21 |
| InChI | InChI=1S/C10H11FO.C2H6/c1-10(2)9-5-8(11)4-3-7(9)6-12-10;1-2/h3-5H,6H2,1-2H3;1-2H3 |
| InChIKey | HXTLMLDDLFASKP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |