C12H12ClFO2 — CID 116532625
4'-(chloromethyl)-6-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane] (PubChem CID 116532625) has the molecular formula C12H12ClFO2 and a molecular weight of 242.68 g/mol. Its IUPAC name is 4'-(chloromethyl)-6-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane].
| Compound Name | 4'-(chloromethyl)-6-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 116532625 |
| Molecular Formula | C12H12ClFO2 |
| Molecular Weight | 242.68 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 4'-(chloromethyl)-6-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane] |
| SMILES | Fc1ccc2c(c1)CCC21OCC(CCl)O1 |
| InChI | InChI=1S/C12H12ClFO2/c13-6-10-7-15-12(16-10)4-3-8-5-9(14)1-2-11(8)12/h1-2,5,10H,3-4,6-7H2 |
| InChIKey | UKKDPQGYXDCMMM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.68 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|