C18H20FN — CID 116532005
5-fluoro-1-(2,4,5-trimethylphenyl)-2,3-dihydroinden-1-amine (PubChem CID 116532005) has the molecular formula C18H20FN and a molecular weight of 269.36 g/mol. Its IUPAC name is 5-fluoro-1-(2,4,5-trimethylphenyl)-2,3-dihydroinden-1-amine.
| Compound Name | 5-fluoro-1-(2,4,5-trimethylphenyl)-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 116532005 |
| Molecular Formula | C18H20FN |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 5-fluoro-1-(2,4,5-trimethylphenyl)-2,3-dihydroinden-1-amine |
| SMILES | Cc1cc(C)c(C2(N)CCc3cc(F)ccc32)cc1C |
| InChI | InChI=1S/C18H20FN/c1-11-8-13(3)17(9-12(11)2)18(20)7-6-14-10-15(19)4-5-16(14)18/h4-5,8-10H,6-7,20H2,1-3H3 |
| InChIKey | HKUYFKUCGCQBGH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |